About (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile (PubChem CID 11277640) has the molecular formula C13H7ClN4S
and a molecular weight of 286.75 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile |
| PubChem CID | 11277640 |
| Molecular Formula | C13H7ClN4S |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C13H7ClN4S/c14-13-16-6-5-9(18-13)8(7-15)12-17-10-3-1-2-4-11(10)19-12/h1-6,17H/b12-8+ |
| InChIKey | KNHMVCIERLWSIP-XYOKQWHBSA-N |
| XLogP | 3.54 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile?
The IUPAC name of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile (CID 11277640) is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile.
What is the SMILES notation for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile?
The canonical SMILES for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile is N#C/C(=C1/Nc2ccccc2S1)c1ccnc(Cl)n1.
What is the InChIKey of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile?
The InChIKey is KNHMVCIERLWSIP-XYOKQWHBSA-N. The full InChI is InChI=1S/C13H7ClN4S/c14-13-16-6-5-9(18-13)8(7-15)12-17-10-3-1-2-4-11(10)19-12/h1-6,17H/b12-8+.
What are the key properties of (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile?
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile has a molecular weight of 286.75 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-(2-chloropyrimidin-4-yl)acetonitrile is sourced from PubChem (CID 11277640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).