About 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol
2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol (PubChem CID 11277657) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
| PubChem CID | 11277657 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
| SMILES | CCc1cccc2c3c([nH]c12)C(CCO)(C(C)C)OCC3 |
| InChI | InChI=1S/C18H25NO2/c1-4-13-6-5-7-14-15-8-11-21-18(9-10-20,12(2)3)17(15)19-16(13)14/h5-7,12,19-20H,4,8-11H2,1-3H3 |
| InChIKey | ABKJMNGZTJSZCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol?
The IUPAC name of 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol (CID 11277657) is 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol.
What is the SMILES notation for 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol?
The canonical SMILES for 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol is CCc1cccc2c3c([nH]c12)C(CCO)(C(C)C)OCC3.
What is the InChIKey of 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol?
The InChIKey is ABKJMNGZTJSZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-4-13-6-5-7-14-15-8-11-21-18(9-10-20,12(2)3)17(15)19-16(13)14/h5-7,12,19-20H,4,8-11H2,1-3H3.
What are the key properties of 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol?
2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol has a molecular weight of 287.40 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-ethyl-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol is sourced from PubChem (CID 11277657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).