C14H28N2O4 — CID 11277679
N,N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]oxamide (PubChem CID 11277679) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is N,N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]oxamide.
| Compound Name | N,N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]oxamide |
|---|---|
| PubChem CID | 11277679 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N,N'-bis[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]oxamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)C(=O)N[C@H](CO)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-13(2,3)9(7-17)15-11(19)12(20)16-10(8-18)14(4,5)6/h9-10,17-18H,7-8H2,1-6H3,(H,15,19)(H,16,20)/t9-,10-/m1/s1 |
| InChIKey | CNXFMUJAXQMUEH-NXEZZACHSA-N |
| XLogP | 0.03 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|