About 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one
2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one (PubChem CID 11277721) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one |
| PubChem CID | 11277721 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one |
| SMILES | COc1cccc(-c2cc(=O)c3ccc4[nH]ccc4c3[nH]2)c1 |
| InChI | InChI=1S/C18H14N2O2/c1-22-12-4-2-3-11(9-12)16-10-17(21)14-5-6-15-13(7-8-19-15)18(14)20-16/h2-10,19H,1H3,(H,20,21) |
| InChIKey | NIHGSTYLBIYJGL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one?
The IUPAC name of 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one (CID 11277721) is 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one.
What is the SMILES notation for 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one?
The canonical SMILES for 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one is COc1cccc(-c2cc(=O)c3ccc4[nH]ccc4c3[nH]2)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one?
The InChIKey is NIHGSTYLBIYJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-22-12-4-2-3-11(9-12)16-10-17(21)14-5-6-15-13(7-8-19-15)18(14)20-16/h2-10,19H,1H3,(H,20,21).
What are the key properties of 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one?
2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one has a molecular weight of 290.32 g/mol, XLogP of 3.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-1,7-dihydropyrrolo[2,3-h]quinolin-4-one is sourced from PubChem (CID 11277721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).