C14H22N6OS — CID 112777640
N-[2-(cyclohexen-1-yl)ethyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide (PubChem CID 112777640) has the molecular formula C14H22N6OS and a molecular weight of 322.44 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 112777640 |
| Molecular Formula | C14H22N6OS |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nc(N)nc(N)n1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H22N6OS/c1-9(22-14-19-12(15)18-13(16)20-14)11(21)17-8-7-10-5-3-2-4-6-10/h5,9H,2-4,6-8H2,1H3,(H,17,21)(H4,15,16,18,19,20) |
| InChIKey | LJFIAOZEPHAHOA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|