About 1,4-dioxaspiro[4.16]henicosa-12,13-diene
1,4-dioxaspiro[4.16]henicosa-12,13-diene (PubChem CID 11277786) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.16]henicosa-12,13-diene.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.16]henicosa-12,13-diene |
| PubChem CID | 11277786 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1,4-dioxaspiro[4.16]henicosa-12,13-diene |
| SMILES | C1=CCCCCCCCC2(CCCCCCC=1)OCCO2 |
| InChI | InChI=1S/C19H32O2/c1-2-4-6-8-10-12-14-16-19(20-17-18-21-19)15-13-11-9-7-5-3-1/h1,4H,3,5-18H2 |
| InChIKey | KHONLZYOQUJUSD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dioxaspiro[4.16]henicosa-12,13-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.16]henicosa-12,13-diene?
The IUPAC name of 1,4-dioxaspiro[4.16]henicosa-12,13-diene (CID 11277786) is 1,4-dioxaspiro[4.16]henicosa-12,13-diene.
What is the SMILES notation for 1,4-dioxaspiro[4.16]henicosa-12,13-diene?
The canonical SMILES for 1,4-dioxaspiro[4.16]henicosa-12,13-diene is C1=CCCCCCCCC2(CCCCCCC=1)OCCO2.
What is the InChIKey of 1,4-dioxaspiro[4.16]henicosa-12,13-diene?
The InChIKey is KHONLZYOQUJUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O2/c1-2-4-6-8-10-12-14-16-19(20-17-18-21-19)15-13-11-9-7-5-3-1/h1,4H,3,5-18H2.
What are the key properties of 1,4-dioxaspiro[4.16]henicosa-12,13-diene?
1,4-dioxaspiro[4.16]henicosa-12,13-diene has a molecular weight of 292.46 g/mol, XLogP of 5.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.16]henicosa-12,13-diene is sourced from PubChem (CID 11277786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).