About 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate
2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate (PubChem CID 11277842) has the molecular formula C15H21NO5
and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate |
| PubChem CID | 11277842 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC2(CC=CC2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO5/c1-14(2,3)21-13(19)16-10(11(17)20-4)9-15(12(16)18)7-5-6-8-15/h5-6,10H,7-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | VAWKXMXXYUXPIB-JTQLQIEISA-N |
| XLogP | 2.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate (CID 11277842) is 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate is COC(=O)[C@@H]1CC2(CC=CC2)C(=O)N1C(=O)OC(C)(C)C.
What is the InChIKey of 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate?
The InChIKey is VAWKXMXXYUXPIB-JTQLQIEISA-N. The full InChI is InChI=1S/C15H21NO5/c1-14(2,3)21-13(19)16-10(11(17)20-4)9-15(12(16)18)7-5-6-8-15/h5-6,10H,7-9H2,1-4H3/t10-/m0/s1.
What are the key properties of 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate?
2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate has a molecular weight of 295.34 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 3-O-methyl (3S)-1-oxo-2-azaspiro[4.4]non-7-ene-2,3-dicarboxylate is sourced from PubChem (CID 11277842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).