C16H20F2O3 — CID 11277924
(4R)-4-[(1R)-2,2-difluoro-1-phenylmethoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11277924) has the molecular formula C16H20F2O3 and a molecular weight of 298.33 g/mol. Its IUPAC name is (4R)-4-[(1R)-2,2-difluoro-1-phenylmethoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1R)-2,2-difluoro-1-phenylmethoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11277924 |
| Molecular Formula | C16H20F2O3 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (4R)-4-[(1R)-2,2-difluoro-1-phenylmethoxybut-3-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC(F)(F)[C@H](OCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H20F2O3/c1-4-16(17,18)14(13-11-20-15(2,3)21-13)19-10-12-8-6-5-7-9-12/h4-9,13-14H,1,10-11H2,2-3H3/t13-,14-/m1/s1 |
| InChIKey | RGXXXAFNDLNUPK-ZIAGYGMSSA-N |
| XLogP | 3.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|