C22H33N3O2S — CID 112783702
N-butan-2-yl-2-[3-(6-methylheptan-2-yl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 112783702) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-butan-2-yl-2-[3-(6-methylheptan-2-yl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-butan-2-yl-2-[3-(6-methylheptan-2-yl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 112783702 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-butan-2-yl-2-[3-(6-methylheptan-2-yl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCC(C)NC(=O)CSc1nc2ccccc2c(=O)n1C(C)CCCC(C)C |
| InChI | InChI=1S/C22H33N3O2S/c1-6-16(4)23-20(26)14-28-22-24-19-13-8-7-12-18(19)21(27)25(22)17(5)11-9-10-15(2)3/h7-8,12-13,15-17H,6,9-11,14H2,1-5H3,(H,23,26) |
| InChIKey | XWZQESWFZHITMP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |