C18H15ClFN3S — CID 112784613
3-[(3-chlorophenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112784613) has the molecular formula C18H15ClFN3S and a molecular weight of 359.86 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(3-chlorophenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112784613 |
| Molecular Formula | C18H15ClFN3S |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-[(3-chlorophenyl)methylsulfanyl]-5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cccc(Cl)c2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C18H15ClFN3S/c1-2-10-23-17(15-8-3-4-9-16(15)20)21-22-18(23)24-12-13-6-5-7-14(19)11-13/h2-9,11H,1,10,12H2 |
| InChIKey | VIQOVAZWOBYNCE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|