C22H19FN4S2 — CID 112785555
3-[4-benzyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 112785555) has the molecular formula C22H19FN4S2 and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-[4-benzyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[4-benzyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 112785555 |
| Molecular Formula | C22H19FN4S2 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[4-benzyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | Fc1ccc(SCCSc2nnc(-c3cccnc3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19FN4S2/c23-19-8-10-20(11-9-19)28-13-14-29-22-26-25-21(18-7-4-12-24-15-18)27(22)16-17-5-2-1-3-6-17/h1-12,15H,13-14,16H2 |
| InChIKey | ROXHPKUBRRIUDR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|