methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate

C17H23NO4 — CID 112786430

IUPACmethyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate
SMILESCOC(=O)c1cccc(OCC(=O)N2CC(C)CC(C)C2)c1
InChIInChI=1S/C17H23NO4/c1-12-7-13(2)10-18(9-12)16(19)11-22-15-6-4-5-14(8-15)17(20)21-3/h4-6,8,12-13H,7,9-11H2,1-3H3
InChIKeyIXIOYFLNQHNZCP-UHFFFAOYSA-N
MW305.37 g/mol
LogP2.36
Rot. Bonds4

About methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate

methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate (PubChem CID 112786430) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate.

Molecular Properties

Compound Namemethyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate
PubChem CID112786430
Molecular FormulaC17H23NO4
Molecular Weight305.37 g/mol
Exact Mass305.16
IUPAC Namemethyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate
SMILESCOC(=O)c1cccc(OCC(=O)N2CC(C)CC(C)C2)c1
InChIInChI=1S/C17H23NO4/c1-12-7-13(2)10-18(9-12)16(19)11-22-15-6-4-5-14(8-15)17(20)21-3/h4-6,8,12-13H,7,9-11H2,1-3H3
InChIKeyIXIOYFLNQHNZCP-UHFFFAOYSA-N
XLogP2.36
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.37
LogP ≤ 52.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate?
The IUPAC name of methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate (CID 112786430) is methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate.
What is the SMILES notation for methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate?
The canonical SMILES for methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate is COC(=O)c1cccc(OCC(=O)N2CC(C)CC(C)C2)c1.
What is the InChIKey of methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate?
The InChIKey is IXIOYFLNQHNZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-12-7-13(2)10-18(9-12)16(19)11-22-15-6-4-5-14(8-15)17(20)21-3/h4-6,8,12-13H,7,9-11H2,1-3H3.
What are the key properties of methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate?
methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate has a molecular weight of 305.37 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoate is sourced from PubChem (CID 112786430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).