About [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate
[(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate (PubChem CID 11278796) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate |
| PubChem CID | 11278796 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](NC(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H19NO4/c1-13(21)24-18-11-17(15-9-5-6-10-16(15)18)20-19(22)23-12-14-7-3-2-4-8-14/h2-10,17-18H,11-12H2,1H3,(H,20,22)/t17-,18+/m0/s1 |
| InChIKey | FCYHILFZEGGUFY-ZWKOTPCHSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate?
The IUPAC name of [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate (CID 11278796) is [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate.
What is the SMILES notation for [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate?
The canonical SMILES for [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate is CC(=O)O[C@@H]1C[C@H](NC(=O)OCc2ccccc2)c2ccccc21.
What is the InChIKey of [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate?
The InChIKey is FCYHILFZEGGUFY-ZWKOTPCHSA-N. The full InChI is InChI=1S/C19H19NO4/c1-13(21)24-18-11-17(15-9-5-6-10-16(15)18)20-19(22)23-12-14-7-3-2-4-8-14/h2-10,17-18H,11-12H2,1H3,(H,20,22)/t17-,18+/m0/s1.
What are the key properties of [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate?
[(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate has a molecular weight of 325.36 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-inden-1-yl] acetate is sourced from PubChem (CID 11278796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).