C23H23NO4 — CID 112789277
N-[(3,4-dimethoxyphenyl)methyl]-4-(phenoxymethyl)benzamide (PubChem CID 112789277) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-(phenoxymethyl)benzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 112789277 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(phenoxymethyl)benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(COc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C23H23NO4/c1-26-21-13-10-18(14-22(21)27-2)15-24-23(25)19-11-8-17(9-12-19)16-28-20-6-4-3-5-7-20/h3-14H,15-16H2,1-2H3,(H,24,25) |
| InChIKey | VQKXERIVGYDMPB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |