C24H30N4O2 — CID 112791080
1-(adamantane-1-carbonyl)-N-(1H-benzimidazol-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 112791080) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-N-(1H-benzimidazol-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(adamantane-1-carbonyl)-N-(1H-benzimidazol-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112791080 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-N-(1H-benzimidazol-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)C1CCCN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H30N4O2/c29-22(25-14-21-26-18-4-1-2-5-19(18)27-21)20-6-3-7-28(20)23(30)24-11-15-8-16(12-24)10-17(9-15)13-24/h1-2,4-5,15-17,20H,3,6-14H2,(H,25,29)(H,26,27) |
| InChIKey | TXJBDHLOKGCAOP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |