C16H21Cl2NO — CID 112792431
2-cyclohexyl-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide (PubChem CID 112792431) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-cyclohexyl-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-cyclohexyl-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 112792431 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-cyclohexyl-N-[(3,4-dichlorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-19(11-13-7-8-14(17)15(18)9-13)16(20)10-12-5-3-2-4-6-12/h7-9,12H,2-6,10-11H2,1H3 |
| InChIKey | CJPGZNLOQFXBPZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |