About (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole
(4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole (PubChem CID 11279421) has the molecular formula C24H43N
and a molecular weight of 345.62 g/mol. Its IUPAC name is (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole |
| PubChem CID | 11279421 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole |
| SMILES | CCCCCC/C=C\CCCCCCCCCC/C=C1\CCN=C1C |
| InChI | InChI=1S/C24H43N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25-23(24)2/h8-9,20H,3-7,10-19,21-22H2,1-2H3/b9-8-,24-20+ |
| InChIKey | CTEOHBYQNVFMJZ-ZIKBOSLESA-N |
| XLogP | 8.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole?
The IUPAC name of (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole (CID 11279421) is (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole.
What is the SMILES notation for (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole?
The canonical SMILES for (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole is CCCCCC/C=C\CCCCCCCCCC/C=C1\CCN=C1C.
What is the InChIKey of (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole?
The InChIKey is CTEOHBYQNVFMJZ-ZIKBOSLESA-N. The full InChI is InChI=1S/C24H43N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-21-22-25-23(24)2/h8-9,20H,3-7,10-19,21-22H2,1-2H3/b9-8-,24-20+.
What are the key properties of (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole?
(4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole has a molecular weight of 345.62 g/mol, XLogP of 8.20, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-methyl-4-[(Z)-nonadec-12-enylidene]-2,3-dihydropyrrole is sourced from PubChem (CID 11279421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).