About N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide
N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide (PubChem CID 112794711) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide |
| PubChem CID | 112794711 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide |
| SMILES | CCCCCC(=O)/N=c1\sccn1C |
| InChI | InChI=1S/C10H16N2OS/c1-3-4-5-6-9(13)11-10-12(2)7-8-14-10/h7-8H,3-6H2,1-2H3/b11-10- |
| InChIKey | IMGDDYSZINMBTH-KHPPLWFESA-N |
| XLogP | 2.09 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide?
The IUPAC name of N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide (CID 112794711) is N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide.
What is the SMILES notation for N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide?
The canonical SMILES for N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide is CCCCCC(=O)/N=c1\sccn1C.
What is the InChIKey of N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide?
The InChIKey is IMGDDYSZINMBTH-KHPPLWFESA-N. The full InChI is InChI=1S/C10H16N2OS/c1-3-4-5-6-9(13)11-10-12(2)7-8-14-10/h7-8H,3-6H2,1-2H3/b11-10-.
What are the key properties of N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide?
N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide has a molecular weight of 212.32 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,3-thiazol-2-ylidene)hexanamide is sourced from PubChem (CID 112794711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).