C18H25FN4OS2 — CID 112795301
4-[5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]morpholine (PubChem CID 112795301) has the molecular formula C18H25FN4OS2 and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-[5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 112795301 |
| Molecular Formula | C18H25FN4OS2 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-[5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-(2-methylpropyl)-1,2,4-triazol-3-yl]morpholine |
| SMILES | CC(C)Cn1c(SCCSc2ccc(F)cc2)nnc1N1CCOCC1 |
| InChI | InChI=1S/C18H25FN4OS2/c1-14(2)13-23-17(22-7-9-24-10-8-22)20-21-18(23)26-12-11-25-16-5-3-15(19)4-6-16/h3-6,14H,7-13H2,1-2H3 |
| InChIKey | TVXVGSYHGFMUSW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|