About N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide
N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (PubChem CID 112795860) has the molecular formula C25H20N6OS2
and a molecular weight of 484.61 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
Molecular Properties
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| PubChem CID | 112795860 |
| Molecular Formula | C25H20N6OS2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| SMILES | O=C(Nc1ncc(Cc2ccccc2)s1)c1ccccc1SCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C25H20N6OS2/c32-24(27-25-26-16-20(34-25)15-18-9-3-1-4-10-18)21-13-7-8-14-22(21)33-17-23-28-29-30-31(23)19-11-5-2-6-12-19/h1-14,16H,15,17H2,(H,26,27,32) |
| InChIKey | RKWPCSDAXQWWEX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide?
The IUPAC name of N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (CID 112795860) is N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
What is the SMILES notation for N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide?
The canonical SMILES for N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide is O=C(Nc1ncc(Cc2ccccc2)s1)c1ccccc1SCc1nnnn1-c1ccccc1.
What is the InChIKey of N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide?
The InChIKey is RKWPCSDAXQWWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N6OS2/c32-24(27-25-26-16-20(34-25)15-18-9-3-1-4-10-18)21-13-7-8-14-22(21)33-17-23-28-29-30-31(23)19-11-5-2-6-12-19/h1-14,16H,15,17H2,(H,26,27,32).
What are the key properties of N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide?
N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide has a molecular weight of 484.61 g/mol, XLogP of 5.25, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzyl-1,3-thiazol-2-yl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide is sourced from PubChem (CID 112795860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).