C20H18N2O2 — CID 112796017
2-cyclopropyl-N-(2-hydroxy-4-methylphenyl)quinoline-4-carboxamide (PubChem CID 112796017) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2-hydroxy-4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-(2-hydroxy-4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 112796017 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-cyclopropyl-N-(2-hydroxy-4-methylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C3CC3)nc3ccccc23)c(O)c1 |
| InChI | InChI=1S/C20H18N2O2/c1-12-6-9-17(19(23)10-12)22-20(24)15-11-18(13-7-8-13)21-16-5-3-2-4-14(15)16/h2-6,9-11,13,23H,7-8H2,1H3,(H,22,24) |
| InChIKey | FXRKFKGHRBTFKG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|