About tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane
tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 11279754) has the molecular formula C19H36O4Si
and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane |
| PubChem CID | 11279754 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@@H](C[C@@H](CC=C)OCOCCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-9-11-17(22-16-21-14-13-20-6)15-18(12-10-2)23-24(7,8)19(3,4)5/h2,9,17-18H,1,11-16H2,3-8H3/t17-,18+/m1/s1 |
| InChIKey | DYEHLMXXDVGPMX-MSOLQXFVSA-N |
| XLogP | 4.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane (CID 11279754) is tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane is C#CC[C@@H](C[C@@H](CC=C)OCOCCOC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane?
The InChIKey is DYEHLMXXDVGPMX-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H36O4Si/c1-9-11-17(22-16-21-14-13-20-6)15-18(12-10-2)23-24(7,8)19(3,4)5/h2,9,17-18H,1,11-16H2,3-8H3/t17-,18+/m1/s1.
What are the key properties of tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane?
tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane has a molecular weight of 356.58 g/mol, XLogP of 4.37, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(4S,6R)-6-(2-methoxyethoxymethoxy)non-8-en-1-yn-4-yl]oxy-dimethylsilane is sourced from PubChem (CID 11279754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).