C18H13N7O2 — CID 11279829
3-[3-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]phenyl]imidazolidine-2,4-dione (PubChem CID 11279829) has the molecular formula C18H13N7O2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-[3-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11279829 |
| Molecular Formula | C18H13N7O2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[3-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1c1cccc(-c2n[nH]c3ccc(-c4ncn[nH]4)cc23)c1 |
| InChI | InChI=1S/C18H13N7O2/c26-15-8-19-18(27)25(15)12-3-1-2-10(6-12)16-13-7-11(17-20-9-21-24-17)4-5-14(13)22-23-16/h1-7,9H,8H2,(H,19,27)(H,22,23)(H,20,21,24) |
| InChIKey | OPZRVYMSYVKHFA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|