About [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate
[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11279911) has the molecular formula C20H31NO3Si
and a molecular weight of 361.56 g/mol. Its IUPAC name is [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 11279911 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC=C=C([C@H](O)c1ccccc1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C20H31NO3Si/c1-15(2)21(16(3)4)20(23)24-14-13-18(25(5,6)7)19(22)17-11-9-8-10-12-17/h8-12,14-16,19,22H,1-7H3/t13?,19-/m1/s1 |
| InChIKey | QLTGJOYYWKMMQI-GAGCMDECSA-N |
| XLogP | 4.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate (CID 11279911) is [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)OC=C=C([C@H](O)c1ccccc1)[Si](C)(C)C)C(C)C.
What is the InChIKey of [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate?
The InChIKey is QLTGJOYYWKMMQI-GAGCMDECSA-N. The full InChI is InChI=1S/C20H31NO3Si/c1-15(2)21(16(3)4)20(23)24-14-13-18(25(5,6)7)19(22)17-11-9-8-10-12-17/h8-12,14-16,19,22H,1-7H3/t13?,19-/m1/s1.
What are the key properties of [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate?
[(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate has a molecular weight of 361.56 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-4-hydroxy-4-phenyl-3-trimethylsilylbuta-1,2-dienyl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 11279911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).