C15H13ClN4O4S2 — CID 112799229
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 112799229) has the molecular formula C15H13ClN4O4S2 and a molecular weight of 412.88 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 112799229 |
| Molecular Formula | C15H13ClN4O4S2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2nc(-c3ccccc3Cl)cs2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H13ClN4O4S2/c1-19-7-12(13(21)20(2)15(19)22)26(23,24)18-14-17-11(8-25-14)9-5-3-4-6-10(9)16/h3-8H,1-2H3,(H,17,18) |
| InChIKey | KJBUKTTXHHJOFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|