C22H34O4 — CID 11279939
[(1R,6S,11S,12R,13R,15S)-11-hydroxy-12-(hydroxymethyl)-6,16-dimethyl-2-methylidene-13-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate (PubChem CID 11279939) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1R,6S,11S,12R,13R,15S)-11-hydroxy-12-(hydroxymethyl)-6,16-dimethyl-2-methylidene-13-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate.
| Compound Name | [(1R,6S,11S,12R,13R,15S)-11-hydroxy-12-(hydroxymethyl)-6,16-dimethyl-2-methylidene-13-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
|---|---|
| PubChem CID | 11279939 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1R,6S,11S,12R,13R,15S)-11-hydroxy-12-(hydroxymethyl)-6,16-dimethyl-2-methylidene-13-tricyclo[7.5.2.012,15]hexadec-9(16)-enyl] acetate |
| SMILES | C=C1CCC[C@H](C)CCC2=C(C)[C@@H]3[C@H]1C[C@@H](OC(C)=O)[C@]3(CO)[C@@H](O)C2 |
| InChI | InChI=1S/C22H34O4/c1-13-6-5-7-14(2)18-11-20(26-16(4)24)22(12-23)19(25)10-17(9-8-13)15(3)21(18)22/h13,18-21,23,25H,2,5-12H2,1,3-4H3/t13-,18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | DPKQFULJRIEIBI-PDDRLDOPSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|