C16H18Cl3NO2 — CID 11279945
3-(2-chloro-3-pyridinyl)propyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 11279945) has the molecular formula C16H18Cl3NO2 and a molecular weight of 362.68 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)propyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 3-(2-chloro-3-pyridinyl)propyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11279945 |
| Molecular Formula | C16H18Cl3NO2 |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)propyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCCCc1cccnc1Cl |
| InChI | InChI=1S/C16H18Cl3NO2/c1-16(2)11(9-12(17)18)13(16)15(21)22-8-4-6-10-5-3-7-20-14(10)19/h3,5,7,9,11,13H,4,6,8H2,1-2H3 |
| InChIKey | SPOCQTCYTIKBGT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|