C25H29N3O — CID 112799826
2-(benzhydrylamino)-N-[2-(dimethylamino)-2-phenylethyl]acetamide (PubChem CID 112799826) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-[2-(dimethylamino)-2-phenylethyl]acetamide.
| Compound Name | 2-(benzhydrylamino)-N-[2-(dimethylamino)-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 112799826 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(benzhydrylamino)-N-[2-(dimethylamino)-2-phenylethyl]acetamide |
| SMILES | CN(C)C(CNC(=O)CNC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O/c1-28(2)23(20-12-6-3-7-13-20)18-26-24(29)19-27-25(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23,25,27H,18-19H2,1-2H3,(H,26,29) |
| InChIKey | NDUVBJDPHNQPQY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |