C23H44OSi — CID 11279999
[(4Z,6E)-7,11-dimethyldodeca-4,6,10-trienoxy]-tri(propan-2-yl)silane (PubChem CID 11279999) has the molecular formula C23H44OSi and a molecular weight of 364.69 g/mol. Its IUPAC name is [(4Z,6E)-7,11-dimethyldodeca-4,6,10-trienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(4Z,6E)-7,11-dimethyldodeca-4,6,10-trienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11279999 |
| Molecular Formula | C23H44OSi |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | [(4Z,6E)-7,11-dimethyldodeca-4,6,10-trienoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)=CCC/C(C)=C/C=C\CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H44OSi/c1-19(2)15-14-17-23(9)16-12-10-11-13-18-24-25(20(3)4,21(5)6)22(7)8/h10,12,15-16,20-22H,11,13-14,17-18H2,1-9H3/b12-10-,23-16+ |
| InChIKey | RMFDTXKJJHQGNT-REDPHMPCSA-N |
| XLogP | 8.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|