C22H27N2OP — CID 11280050
diphenyl-[(2S)-2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane (PubChem CID 11280050) has the molecular formula C22H27N2OP and a molecular weight of 366.44 g/mol. Its IUPAC name is diphenyl-[(2S)-2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane.
| Compound Name | diphenyl-[(2S)-2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane |
|---|---|
| PubChem CID | 11280050 |
| Molecular Formula | C22H27N2OP |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | diphenyl-[(2S)-2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]phosphane |
| SMILES | CC(C)[C@@H]1COC([C@@H]2CCCN2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C22H27N2OP/c1-17(2)20-16-25-22(23-20)21-14-9-15-24(21)26(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,17,20-21H,9,14-16H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | OGRLTUDSZRCRDO-SFTDATJTSA-N |
| XLogP | 3.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|