C26H24N2O4 — CID 112800527
[4-(3-hydroxyphenyl)piperazin-1-yl]-[5-(naphthalen-2-yloxymethyl)furan-2-yl]methanone (PubChem CID 112800527) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-(naphthalen-2-yloxymethyl)furan-2-yl]methanone.
| Compound Name | [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-(naphthalen-2-yloxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 112800527 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [4-(3-hydroxyphenyl)piperazin-1-yl]-[5-(naphthalen-2-yloxymethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc3ccccc3c2)o1)N1CCN(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C26H24N2O4/c29-22-7-3-6-21(17-22)27-12-14-28(15-13-27)26(30)25-11-10-24(32-25)18-31-23-9-8-19-4-1-2-5-20(19)16-23/h1-11,16-17,29H,12-15,18H2 |
| InChIKey | WHXWKERZEBSVGZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |