C16H22N2O8 — CID 11280148
ethyl (2S,3S)-4-[(1S,5R,7R)-10,10-dimethyl-3-oxo-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-2-nitro-4-oxobutanoate (PubChem CID 11280148) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is ethyl (2S,3S)-4-[(1S,5R,7R)-10,10-dimethyl-3-oxo-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-2-nitro-4-oxobutanoate.
| Compound Name | ethyl (2S,3S)-4-[(1S,5R,7R)-10,10-dimethyl-3-oxo-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-2-nitro-4-oxobutanoate |
|---|---|
| PubChem CID | 11280148 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl (2S,3S)-4-[(1S,5R,7R)-10,10-dimethyl-3-oxo-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-2-nitro-4-oxobutanoate |
| SMILES | CCOC(=O)[C@H]([C@H](O)C(=O)N1C(=O)O[C@@H]2C[C@H]3CC[C@]21C3(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O8/c1-4-25-13(21)10(18(23)24)11(19)12(20)17-14(22)26-9-7-8-5-6-16(9,17)15(8,2)3/h8-11,19H,4-7H2,1-3H3/t8-,9-,10+,11+,16-/m1/s1 |
| InChIKey | XNKSENBOFJYIIO-AEKLZTMFSA-N |
| XLogP | 0.48 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|