C18H20IN3O — CID 112801637
2-[cyclopropyl(pyridin-3-ylmethyl)amino]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 112801637) has the molecular formula C18H20IN3O and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-[cyclopropyl(pyridin-3-ylmethyl)amino]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[cyclopropyl(pyridin-3-ylmethyl)amino]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 112801637 |
| Molecular Formula | C18H20IN3O |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[cyclopropyl(pyridin-3-ylmethyl)amino]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN(Cc1cccnc1)C1CC1 |
| InChI | InChI=1S/C18H20IN3O/c1-13-9-15(19)4-7-17(13)21-18(23)12-22(16-5-6-16)11-14-3-2-8-20-10-14/h2-4,7-10,16H,5-6,11-12H2,1H3,(H,21,23) |
| InChIKey | AMQFWCGDYDNKDW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|