C19H19N5O3S — CID 112802457
2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-nitrophenyl)ethanone (PubChem CID 112802457) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 112802457 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[1-(4-butylphenyl)tetrazol-5-yl]sulfanyl-1-(3-nitrophenyl)ethanone |
| SMILES | CCCCc1ccc(-n2nnnc2SCC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H19N5O3S/c1-2-3-5-14-8-10-16(11-9-14)23-19(20-21-22-23)28-13-18(25)15-6-4-7-17(12-15)24(26)27/h4,6-12H,2-3,5,13H2,1H3 |
| InChIKey | OLAAXLKMLZGOAC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|