C23H28N4O3 — CID 112802636
5-methyl-3-[2-[2-(1-methylpyrrol-2-yl)azepan-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 112802636) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 5-methyl-3-[2-[2-(1-methylpyrrol-2-yl)azepan-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[2-[2-(1-methylpyrrol-2-yl)azepan-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112802636 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 5-methyl-3-[2-[2-(1-methylpyrrol-2-yl)azepan-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cn1cccc1C1CCCCCN1C(=O)CN1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H28N4O3/c1-23(17-10-5-3-6-11-17)21(29)27(22(30)24-23)16-20(28)26-15-8-4-7-12-19(26)18-13-9-14-25(18)2/h3,5-6,9-11,13-14,19H,4,7-8,12,15-16H2,1-2H3,(H,24,30) |
| InChIKey | YDFNGNMLGUKGEA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|