C22H25ClN2O2 — CID 112802698
4-chloro-N-[1-[cyclopentyl(methyl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 112802698) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 4-chloro-N-[1-[cyclopentyl(methyl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[cyclopentyl(methyl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 112802698 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-chloro-N-[1-[cyclopentyl(methyl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | CN(C(=O)C(Cc1ccccc1)NC(=O)c1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-25(19-9-5-6-10-19)22(27)20(15-16-7-3-2-4-8-16)24-21(26)17-11-13-18(23)14-12-17/h2-4,7-8,11-14,19-20H,5-6,9-10,15H2,1H3,(H,24,26) |
| InChIKey | HYTBBFYZUOEPOY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |