C20H19F2N3O3S2 — CID 112802975
3-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112802975) has the molecular formula C20H19F2N3O3S2 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112802975 |
| Molecular Formula | C20H19F2N3O3S2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(S(=O)(=O)C(F)F)cc2)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C20H19F2N3O3S2/c1-3-12-25-18(16-6-4-5-7-17(16)28-2)23-24-20(25)29-13-14-8-10-15(11-9-14)30(26,27)19(21)22/h3-11,19H,1,12-13H2,2H3 |
| InChIKey | KEULHKHJPZZUKM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|