C20H18ClF2N3O3S2 — CID 112803000
3-[(4-chlorophenoxy)methyl]-5-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112803000) has the molecular formula C20H18ClF2N3O3S2 and a molecular weight of 485.97 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-5-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-5-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112803000 |
| Molecular Formula | C20H18ClF2N3O3S2 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-5-[[4-(difluoromethylsulfonyl)phenyl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(COc2ccc(Cl)cc2)nnc1SCc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF2N3O3S2/c1-2-11-26-18(12-29-16-7-5-15(21)6-8-16)24-25-20(26)30-13-14-3-9-17(10-4-14)31(27,28)19(22)23/h2-10,19H,1,11-13H2 |
| InChIKey | MXSIVYCYCPURPJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|