C14H10F4N2O4S — CID 11280370
2,2,3,3-tetrafluoro-6-[4-(sulfamoylamino)phenyl]-1,4-benzodioxine (PubChem CID 11280370) has the molecular formula C14H10F4N2O4S and a molecular weight of 378.30 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-[4-(sulfamoylamino)phenyl]-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetrafluoro-6-[4-(sulfamoylamino)phenyl]-1,4-benzodioxine |
|---|---|
| PubChem CID | 11280370 |
| Molecular Formula | C14H10F4N2O4S |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-[4-(sulfamoylamino)phenyl]-1,4-benzodioxine |
| SMILES | NS(=O)(=O)Nc1ccc(-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C14H10F4N2O4S/c15-13(16)14(17,18)24-12-7-9(3-6-11(12)23-13)8-1-4-10(5-2-8)20-25(19,21)22/h1-7,20H,(H2,19,21,22) |
| InChIKey | NPKDGTGKGPCJNS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|