C24H25N3O3S — CID 112804151
N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 112804151) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 112804151 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(C(=O)N2CCC(NC(=O)c3csc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-2-30-20-10-8-18(9-11-20)24(29)27-14-12-19(13-15-27)25-22(28)21-16-31-23(26-21)17-6-4-3-5-7-17/h3-11,16,19H,2,12-15H2,1H3,(H,25,28) |
| InChIKey | IUAUOINSSCOQHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |