C17H20N10O — CID 11280440
2-(furan-2-yl)-5-[4-[(5-methyl-1H-imidazol-4-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11280440) has the molecular formula C17H20N10O and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-[(5-methyl-1H-imidazol-4-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-[(5-methyl-1H-imidazol-4-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11280440 |
| Molecular Formula | C17H20N10O |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-[(5-methyl-1H-imidazol-4-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Cc1[nH]cnc1CN1CCN(c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C17H20N10O/c1-11-12(20-10-19-11)9-25-4-6-26(7-5-25)16-22-15(18)27-17(23-16)21-14(24-27)13-3-2-8-28-13/h2-3,8,10H,4-7,9H2,1H3,(H,19,20)(H2,18,21,22,23,24) |
| InChIKey | HLMWKCMXNWJGGO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |