C19H28O4SSi — CID 11280457
[(1R,4S,7R)-2-(benzenesulfonyl)-8-oxabicyclo[5.1.0]oct-2-en-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11280457) has the molecular formula C19H28O4SSi and a molecular weight of 380.58 g/mol. Its IUPAC name is [(1R,4S,7R)-2-(benzenesulfonyl)-8-oxabicyclo[5.1.0]oct-2-en-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4S,7R)-2-(benzenesulfonyl)-8-oxabicyclo[5.1.0]oct-2-en-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11280457 |
| Molecular Formula | C19H28O4SSi |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [(1R,4S,7R)-2-(benzenesulfonyl)-8-oxabicyclo[5.1.0]oct-2-en-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(S(=O)(=O)c2ccccc2)[C@@H]2O[C@@H]2CC1 |
| InChI | InChI=1S/C19H28O4SSi/c1-19(2,3)25(4,5)23-14-11-12-16-18(22-16)17(13-14)24(20,21)15-9-7-6-8-10-15/h6-10,13-14,16,18H,11-12H2,1-5H3/t14-,16+,18+/m0/s1 |
| InChIKey | ZDHJHJDJQFNHLX-YXJHDRRASA-N |
| XLogP | 4.30 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|