C22H38O5 — CID 11280521
(E)-5-[(1R,4R,5R,7R)-4-(3-hydroxybutyl)-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-en-1-ol (PubChem CID 11280521) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is (E)-5-[(1R,4R,5R,7R)-4-(3-hydroxybutyl)-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-en-1-ol.
| Compound Name | (E)-5-[(1R,4R,5R,7R)-4-(3-hydroxybutyl)-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 11280521 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (E)-5-[(1R,4R,5R,7R)-4-(3-hydroxybutyl)-7-(methoxymethoxy)-4,5-dimethyl-3,5,6,7-tetrahydro-1H-2-benzofuran-1-yl]-4-methylpent-4-en-1-ol |
| SMILES | COCO[C@@H]1C[C@@H](C)[C@@](C)(CCC(C)O)C2=C1[C@@H](/C=C(\C)CCCO)OC2 |
| InChI | InChI=1S/C22H38O5/c1-15(7-6-10-23)11-19-21-18(13-26-19)22(4,9-8-17(3)24)16(2)12-20(21)27-14-25-5/h11,16-17,19-20,23-24H,6-10,12-14H2,1-5H3/b15-11+/t16-,17?,19-,20-,22-/m1/s1 |
| InChIKey | VYFAMMCOCKNHAG-OSRYUEPBSA-N |
| XLogP | 3.60 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|