C21H26N6O3S — CID 112805997
N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide (PubChem CID 112805997) has the molecular formula C21H26N6O3S and a molecular weight of 442.55 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 112805997 |
| Molecular Formula | C21H26N6O3S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[4-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)CN2CCN(Cc3nnc(-c4cc5c(s4)CCCC5)o3)CC2)no1 |
| InChI | InChI=1S/C21H26N6O3S/c1-14-10-18(25-30-14)22-19(28)12-26-6-8-27(9-7-26)13-20-23-24-21(29-20)17-11-15-4-2-3-5-16(15)31-17/h10-11H,2-9,12-13H2,1H3,(H,22,25,28) |
| InChIKey | CQFRATVGDKOQFD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |