C25H38O3 — CID 11280640
(2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenal (PubChem CID 11280640) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenal.
| Compound Name | (2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenal |
|---|---|
| PubChem CID | 11280640 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (2R,3E,5E,8R,9Z,11E)-10-ethyl-2,4,8-trimethyl-12-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]dodeca-3,5,9,11-tetraenal |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C=O)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C25H38O3/c1-7-23(14-15-24-12-9-13-25(28-24)27-19(2)3)17-21(5)11-8-10-20(4)16-22(6)18-26/h8-10,13-19,21-22,24-25H,7,11-12H2,1-6H3/b10-8+,15-14+,20-16+,23-17-/t21-,22-,24-,25-/m1/s1 |
| InChIKey | YGYBZZQIVYXVIH-ZKTLRFNCSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|