C19H24F3NO — CID 112806629
N-cycloheptyl-N-methyl-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 112806629) has the molecular formula C19H24F3NO and a molecular weight of 339.40 g/mol. Its IUPAC name is N-cycloheptyl-N-methyl-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-cycloheptyl-N-methyl-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 112806629 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-cycloheptyl-N-methyl-2-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CN(C(=O)C1CC1c1ccccc1C(F)(F)F)C1CCCCCC1 |
| InChI | InChI=1S/C19H24F3NO/c1-23(13-8-4-2-3-5-9-13)18(24)16-12-15(16)14-10-6-7-11-17(14)19(20,21)22/h6-7,10-11,13,15-16H,2-5,8-9,12H2,1H3 |
| InChIKey | WRDLQZMTQCKIFB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |