C21H25BrN2O4 — CID 112807430
methyl 4-[[2-[1-(3-bromo-4-methoxyphenyl)ethylamino]propanoylamino]methyl]benzoate (PubChem CID 112807430) has the molecular formula C21H25BrN2O4 and a molecular weight of 449.35 g/mol. Its IUPAC name is methyl 4-[[2-[1-(3-bromo-4-methoxyphenyl)ethylamino]propanoylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[1-(3-bromo-4-methoxyphenyl)ethylamino]propanoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 112807430 |
| Molecular Formula | C21H25BrN2O4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | methyl 4-[[2-[1-(3-bromo-4-methoxyphenyl)ethylamino]propanoylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C(C)NC(C)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C21H25BrN2O4/c1-13(17-9-10-19(27-3)18(22)11-17)24-14(2)20(25)23-12-15-5-7-16(8-6-15)21(26)28-4/h5-11,13-14,24H,12H2,1-4H3,(H,23,25) |
| InChIKey | IWQNZIKEKBIHJX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |