C19H21N3OS3 — CID 112807871
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)benzamide (PubChem CID 112807871) has the molecular formula C19H21N3OS3 and a molecular weight of 403.60 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)benzamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 112807871 |
| Molecular Formula | C19H21N3OS3 |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-(5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2c(s1)CCCCC2)c1ccccc1CSC1=NCCS1 |
| InChI | InChI=1S/C19H21N3OS3/c23-17(22-18-21-15-8-2-1-3-9-16(15)26-18)14-7-5-4-6-13(14)12-25-19-20-10-11-24-19/h4-7H,1-3,8-12H2,(H,21,22,23) |
| InChIKey | PJJXQYGGJMJTDP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |