About methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate
methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate (PubChem CID 11280843) has the molecular formula C25H19N3O2
and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate |
| PubChem CID | 11280843 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c[nH]c2c1 |
| InChI | InChI=1S/C25H19N3O2/c1-30-25(29)18-12-13-19-20(15-26-21(19)14-18)24-27-22(16-8-4-2-5-9-16)23(28-24)17-10-6-3-7-11-17/h2-15,26H,1H3,(H,27,28) |
| InChIKey | DNNBJPVYZULRSW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate?
The IUPAC name of methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate (CID 11280843) is methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate?
The canonical SMILES for methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate is COC(=O)c1ccc2c(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c[nH]c2c1.
What is the InChIKey of methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate?
The InChIKey is DNNBJPVYZULRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N3O2/c1-30-25(29)18-12-13-19-20(15-26-21(19)14-18)24-27-22(16-8-4-2-5-9-16)23(28-24)17-10-6-3-7-11-17/h2-15,26H,1H3,(H,27,28).
What are the key properties of methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate?
methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate has a molecular weight of 393.45 g/mol, XLogP of 5.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,5-diphenyl-1H-imidazol-2-yl)-1H-indole-6-carboxylate is sourced from PubChem (CID 11280843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).