C24H29NO2S — CID 11280908
(5R,6S,8S)-12-methoxy-6,10-dimethyl-8-(2-methylprop-1-enyl)-3-phenyl-3λ6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,9(13),10-tetraene 3-oxide (PubChem CID 11280908) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is (5R,6S,8S)-12-methoxy-6,10-dimethyl-8-(2-methylprop-1-enyl)-3-phenyl-3λ6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,9(13),10-tetraene 3-oxide.
| Compound Name | (5R,6S,8S)-12-methoxy-6,10-dimethyl-8-(2-methylprop-1-enyl)-3-phenyl-3λ6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,9(13),10-tetraene 3-oxide |
|---|---|
| PubChem CID | 11280908 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (5R,6S,8S)-12-methoxy-6,10-dimethyl-8-(2-methylprop-1-enyl)-3-phenyl-3λ6-thia-2-azatricyclo[7.3.1.05,13]trideca-1(12),2,9(13),10-tetraene 3-oxide |
| SMILES | COc1cc(C)c2c3c1N=S(=O)(c1ccccc1)C[C@@H]3[C@@H](C)C[C@H]2C=C(C)C |
| InChI | InChI=1S/C24H29NO2S/c1-15(2)11-18-12-16(3)20-14-28(26,19-9-7-6-8-10-19)25-24-21(27-5)13-17(4)22(18)23(20)24/h6-11,13,16,18,20H,12,14H2,1-5H3/t16-,18+,20+,28?/m0/s1 |
| InChIKey | MPGUCNYJYKBOFV-HACASVNNSA-N |
| XLogP | 6.35 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|